About 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine
4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58791427) has the molecular formula C21H25F3N4OS
and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| PubChem CID | 58791427 |
| Molecular Formula | C21H25F3N4OS |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(-c3cnc[nH]3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H25F3N4OS/c1-2-3-4-5-6-7-10-29-19-9-8-15(11-16(19)21(22,23)24)27-20-28-18(13-30-20)17-12-25-14-26-17/h8-9,11-14H,2-7,10H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | FMPUUNMTXVWDPI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (CID 58791427) is 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is CCCCCCCCOc1ccc(Nc2nc(-c3cnc[nH]3)cs2)cc1C(F)(F)F.
What is the InChIKey of 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The InChIKey is FMPUUNMTXVWDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F3N4OS/c1-2-3-4-5-6-7-10-29-19-9-8-15(11-16(19)21(22,23)24)27-20-28-18(13-30-20)17-12-25-14-26-17/h8-9,11-14H,2-7,10H2,1H3,(H,25,26)(H,27,28).
What are the key properties of 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine has a molecular weight of 438.52 g/mol, XLogP of 7.03, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazol-5-yl)-N-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 58791427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).