C24H28F3N3OS — CID 58791923
4-N-[4-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-1-N-methyl-1-N-pentyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 58791923) has the molecular formula C24H28F3N3OS and a molecular weight of 463.57 g/mol. Its IUPAC name is 4-N-[4-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-1-N-methyl-1-N-pentyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-1-N-methyl-1-N-pentyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 58791923 |
| Molecular Formula | C24H28F3N3OS |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-N-[4-[(4-methoxyphenyl)methyl]-1,3-thiazol-2-yl]-1-N-methyl-1-N-pentyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCCCCN(C)c1ccc(Nc2nc(Cc3ccc(OC)cc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H28F3N3OS/c1-4-5-6-13-30(2)22-12-9-18(15-21(22)24(25,26)27)28-23-29-19(16-32-23)14-17-7-10-20(31-3)11-8-17/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,28,29) |
| InChIKey | WOKTZWPFCYDTKE-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|