C24H30F3N5OS — CID 58791943
4-N-[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]-1-N-methyl-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 58791943) has the molecular formula C24H30F3N5OS and a molecular weight of 493.60 g/mol. Its IUPAC name is 4-N-[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]-1-N-methyl-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]-1-N-methyl-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 58791943 |
| Molecular Formula | C24H30F3N5OS |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-N-[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]-1-N-methyl-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCCCCCCCN(C)c1ccc(Nc2nc(-c3cnc(OC)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H30F3N5OS/c1-4-5-6-7-8-9-12-32(2)21-11-10-18(13-19(21)24(25,26)27)30-23-31-20(16-34-23)17-14-28-22(33-3)29-15-17/h10-11,13-16H,4-9,12H2,1-3H3,(H,30,31) |
| InChIKey | BCEZHKYXXPVZFX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|