C15H16FN3O2 — CID 58792070
3'-(2-fluorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-imidazolidine]-2',4'-dione (PubChem CID 58792070) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 3'-(2-fluorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(2-fluorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 58792070 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3'-(2-fluorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CN3CCC2CC3)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C15H16FN3O2/c16-11-3-1-2-4-12(11)19-13(20)15(17-14(19)21)9-18-7-5-10(15)6-8-18/h1-4,10H,5-9H2,(H,17,21) |
| InChIKey | XSIGRRUKDQWILX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|