About 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine
4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine (PubChem CID 58792104) has the molecular formula C7H11N3OS3
and a molecular weight of 249.39 g/mol. Its IUPAC name is 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine.
Molecular Properties
| Compound Name | 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine |
| PubChem CID | 58792104 |
| Molecular Formula | C7H11N3OS3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine |
| SMILES | CSOc1nsc(N2CCSCC2)n1 |
| InChI | InChI=1S/C7H11N3OS3/c1-12-11-6-8-7(14-9-6)10-2-4-13-5-3-10/h2-5H2,1H3 |
| InChIKey | FCOCUAPZNOXHDS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine?
The IUPAC name of 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine (CID 58792104) is 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine.
What is the SMILES notation for 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine?
The canonical SMILES for 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine is CSOc1nsc(N2CCSCC2)n1.
What is the InChIKey of 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine?
The InChIKey is FCOCUAPZNOXHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS3/c1-12-11-6-8-7(14-9-6)10-2-4-13-5-3-10/h2-5H2,1H3.
What are the key properties of 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine?
4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine has a molecular weight of 249.39 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylsulfanyloxy-1,2,4-thiadiazol-5-yl)thiomorpholine is sourced from PubChem (CID 58792104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).