About ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate
ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate (PubChem CID 58792336) has the molecular formula C12H17F3O5S
and a molecular weight of 330.32 g/mol. Its IUPAC name is ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate.
Molecular Properties
| Compound Name | ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate |
| PubChem CID | 58792336 |
| Molecular Formula | C12H17F3O5S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate |
| SMILES | CCOC(=O)/C=C(/CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O5S/c1-4-19-11(16)8-10(7-5-6-9(2)3)20-21(17,18)12(13,14)15/h6,8H,4-5,7H2,1-3H3/b10-8- |
| InChIKey | MYRNKXPHVJWUHM-NTMALXAHSA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate?
The IUPAC name of ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate (CID 58792336) is ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate.
What is the SMILES notation for ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate?
The canonical SMILES for ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate is CCOC(=O)/C=C(/CCC=C(C)C)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate?
The InChIKey is MYRNKXPHVJWUHM-NTMALXAHSA-N. The full InChI is InChI=1S/C12H17F3O5S/c1-4-19-11(16)8-10(7-5-6-9(2)3)20-21(17,18)12(13,14)15/h6,8H,4-5,7H2,1-3H3/b10-8-.
What are the key properties of ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate?
ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate has a molecular weight of 330.32 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-7-methyl-3-(trifluoromethylsulfonyloxy)octa-2,6-dienoate is sourced from PubChem (CID 58792336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).