C26H39F3O5S — CID 58792342
ethyl (2Z,6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate (PubChem CID 58792342) has the molecular formula C26H39F3O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is ethyl (2Z,6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate.
| Compound Name | ethyl (2Z,6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 58792342 |
| Molecular Formula | C26H39F3O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | ethyl (2Z,6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate |
| SMILES | CCOC(=O)/C=C(/CC/C=C(\CC=C(C)C)CC/C=C(\C)CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C26H39F3O5S/c1-7-33-25(30)19-24(34-35(31,32)26(27,28)29)16-10-15-23(18-17-21(4)5)14-9-13-22(6)12-8-11-20(2)3/h11,13,15,17,19H,7-10,12,14,16,18H2,1-6H3/b22-13+,23-15-,24-19- |
| InChIKey | ZHNWARYNXUXWLQ-MBDJOFSDSA-N |
| XLogP | 7.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|