C21H31F3O5S — CID 58792343
ethyl (2Z,6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate (PubChem CID 58792343) has the molecular formula C21H31F3O5S and a molecular weight of 452.54 g/mol. Its IUPAC name is ethyl (2Z,6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate.
| Compound Name | ethyl (2Z,6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 58792343 |
| Molecular Formula | C21H31F3O5S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl (2Z,6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C=C(/CC/C=C(\CC=C(C)C)CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H31F3O5S/c1-6-28-20(25)15-19(29-30(26,27)21(22,23)24)12-8-11-18(14-13-17(4)5)10-7-9-16(2)3/h9,11,13,15H,6-8,10,12,14H2,1-5H3/b18-11-,19-15- |
| InChIKey | AAGSQUCXFFGSRT-PCCVJEDISA-N |
| XLogP | 6.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|