C25H40O3 — CID 58792354
ethyl (6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-oxohexadeca-6,10,14-trienoate (PubChem CID 58792354) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is ethyl (6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-oxohexadeca-6,10,14-trienoate.
| Compound Name | ethyl (6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-oxohexadeca-6,10,14-trienoate |
|---|---|
| PubChem CID | 58792354 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | ethyl (6Z,10E)-11,15-dimethyl-7-(3-methylbut-2-enyl)-3-oxohexadeca-6,10,14-trienoate |
| SMILES | CCOC(=O)CC(=O)CC/C=C(\CC=C(C)C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40O3/c1-7-28-25(27)19-24(26)16-10-15-23(18-17-21(4)5)14-9-13-22(6)12-8-11-20(2)3/h11,13,15,17H,7-10,12,14,16,18-19H2,1-6H3/b22-13+,23-15- |
| InChIKey | DMGZDTWLZSJVFY-XJZCQYRTSA-N |
| XLogP | 7.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|