C25H40O2 — CID 58792495
5,5-dimethyl-2-[(1E,3E,5E,9E)-2,6,10,14-tetramethylpentadeca-1,3,5,9,13-pentaenyl]-1,3-dioxane (PubChem CID 58792495) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(1E,3E,5E,9E)-2,6,10,14-tetramethylpentadeca-1,3,5,9,13-pentaenyl]-1,3-dioxane.
| Compound Name | 5,5-dimethyl-2-[(1E,3E,5E,9E)-2,6,10,14-tetramethylpentadeca-1,3,5,9,13-pentaenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 58792495 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 5,5-dimethyl-2-[(1E,3E,5E,9E)-2,6,10,14-tetramethylpentadeca-1,3,5,9,13-pentaenyl]-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C1OCC(C)(C)CO1 |
| InChI | InChI=1S/C25H40O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-23(5)17-24-26-18-25(6,7)19-27-24/h10-11,13,15-17,24H,8-9,12,14,18-19H2,1-7H3/b16-10+,21-13+,22-15+,23-17+ |
| InChIKey | HYGCJBZKFAYIRI-AXZACKSLSA-N |
| XLogP | 7.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|