About CID 58792551
CID 58792551 (PubChem CID 58792551) has the molecular formula C4H8N
and a molecular weight of 70.11 g/mol.
Molecular Properties
| Compound Name | CID 58792551 |
| PubChem CID | 58792551 |
| Molecular Formula | C4H8N |
| Molecular Weight | 70.11 g/mol |
| Exact Mass | 70.07 |
| IUPAC Name | — |
| SMILES | C=N[C](C)C |
| InChI | InChI=1S/C4H8N/c1-4(2)5-3/h3H2,1-2H3 |
| InChIKey | ACCHPDULYKIBMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 70.11 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58792551 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58792551?
The IUPAC name of CID 58792551 (CID 58792551) is not available.
What is the SMILES notation for CID 58792551?
The canonical SMILES for CID 58792551 is C=N[C](C)C.
What is the InChIKey of CID 58792551?
The InChIKey is ACCHPDULYKIBMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N/c1-4(2)5-3/h3H2,1-2H3.
What are the key properties of CID 58792551?
CID 58792551 has a molecular weight of 70.11 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58792551 is sourced from PubChem (CID 58792551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).