C20H34O5 — CID 58792591
2-ethylpentyl 4'-methylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-oxane]-5-carboxylate (PubChem CID 58792591) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-ethylpentyl 4'-methylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-oxane]-5-carboxylate.
| Compound Name | 2-ethylpentyl 4'-methylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-oxane]-5-carboxylate |
|---|---|
| PubChem CID | 58792591 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-ethylpentyl 4'-methylspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-oxane]-5-carboxylate |
| SMILES | CCCC(CC)COC(=O)C1CCC2OC3(CC(C)CCO3)OC2C1 |
| InChI | InChI=1S/C20H34O5/c1-4-6-15(5-2)13-22-19(21)16-7-8-17-18(11-16)25-20(24-17)12-14(3)9-10-23-20/h14-18H,4-13H2,1-3H3 |
| InChIKey | VUDROGGMRJGNNN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |