About N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide
N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide (PubChem CID 58792662) has the molecular formula C10H20F2N2O2
and a molecular weight of 238.28 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide |
| PubChem CID | 58792662 |
| Molecular Formula | C10H20F2N2O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide |
| SMILES | CC(C)(COC(F)CF)C(=O)NCCCN |
| InChI | InChI=1S/C10H20F2N2O2/c1-10(2,7-16-8(12)6-11)9(15)14-5-3-4-13/h8H,3-7,13H2,1-2H3,(H,14,15) |
| InChIKey | RBALHMBGGYNVTJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide?
The IUPAC name of N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide (CID 58792662) is N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide?
The canonical SMILES for N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide is CC(C)(COC(F)CF)C(=O)NCCCN.
What is the InChIKey of N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide?
The InChIKey is RBALHMBGGYNVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2N2O2/c1-10(2,7-16-8(12)6-11)9(15)14-5-3-4-13/h8H,3-7,13H2,1-2H3,(H,14,15).
What are the key properties of N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide?
N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide has a molecular weight of 238.28 g/mol, XLogP of 0.76, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-3-(1,2-difluoroethoxy)-2,2-dimethylpropanamide is sourced from PubChem (CID 58792662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).