C19H16ClF3N2O4S — CID 58792671
6-chloro-1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 58792671) has the molecular formula C19H16ClF3N2O4S and a molecular weight of 460.86 g/mol. Its IUPAC name is 6-chloro-1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-chloro-1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792671 |
| Molecular Formula | C19H16ClF3N2O4S |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 6-chloro-1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2cc(Cl)ccc2N1C1CCN(S(=O)(=O)c2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C19H16ClF3N2O4S/c20-12-1-2-17-11(7-12)10-29-19(26)25(17)13-3-5-24(6-4-13)30(27,28)18-9-15(22)14(21)8-16(18)23/h1-2,7-9,13H,3-6,10H2 |
| InChIKey | RCTKXQZMNNOHIQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|