C19H17F3N2O4S — CID 58792846
1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 58792846) has the molecular formula C19H17F3N2O4S and a molecular weight of 426.42 g/mol. Its IUPAC name is 1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792846 |
| Molecular Formula | C19H17F3N2O4S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[1-(2,4,5-trifluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2ccccc2N1C1CCN(S(=O)(=O)c2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C19H17F3N2O4S/c20-14-9-16(22)18(10-15(14)21)29(26,27)23-7-5-13(6-8-23)24-17-4-2-1-3-12(17)11-28-19(24)25/h1-4,9-10,13H,5-8,11H2 |
| InChIKey | FNQXUMYNJVXYDA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|