C51H32F6IrN2-2 — CID 58793047
2-(2',7'-diphenylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine (PubChem CID 58793047) has the molecular formula C51H32F6IrN2-2 and a molecular weight of 979.04 g/mol. Its IUPAC name is 2-(2',7'-diphenylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine.
| Compound Name | 2-(2',7'-diphenylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 58793047 |
| Molecular Formula | C51H32F6IrN2-2 |
| Molecular Weight | 979.04 g/mol |
| Exact Mass | 979.21 |
| IUPAC Name | 2-(2',7'-diphenylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.[Ir].[c-]1cc2c(cc1-c1ccccn1)CC1(C2)c2cc(-c3ccccc3)ccc2-c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C38H26N.C13H6F6N.Ir/c1-3-9-26(10-4-1)28-16-18-33-34-19-17-29(27-11-5-2-6-12-27)23-36(34)38(35(33)22-28)24-31-15-14-30(21-32(31)25-38)37-13-7-8-20-39-37;14-12(15,16)9-6-10(8-4-2-1-3-5-8)20-11(7-9)13(17,18)19;/h1-13,15-23H,24-25H2;1-4,6-7H;/q2*-1; |
| InChIKey | GVULOPXIQLTBSF-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.04 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|