C59H36F6IrN2-2 — CID 58793155
2-(2',7'-dinaphthalen-1-ylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine (PubChem CID 58793155) has the molecular formula C59H36F6IrN2-2 and a molecular weight of 1079.16 g/mol. Its IUPAC name is 2-(2',7'-dinaphthalen-1-ylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine.
| Compound Name | 2-(2',7'-dinaphthalen-1-ylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 58793155 |
| Molecular Formula | C59H36F6IrN2-2 |
| Molecular Weight | 1079.16 g/mol |
| Exact Mass | 1079.24 |
| IUPAC Name | 2-(2',7'-dinaphthalen-1-ylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine;iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.[Ir].[c-]1cc2c(cc1-c1ccccn1)CC1(C2)c2cc(-c3cccc4ccccc34)ccc2-c2ccc(-c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C46H30N.C13H6F6N.Ir/c1-3-13-37-30(9-1)11-7-15-39(37)32-20-22-41-42-23-21-33(40-16-8-12-31-10-2-4-14-38(31)40)27-44(42)46(43(41)26-32)28-35-19-18-34(25-36(35)29-46)45-17-5-6-24-47-45;14-12(15,16)9-6-10(8-4-2-1-3-5-8)20-11(7-9)13(17,18)19;/h1-17,19-27H,28-29H2;1-4,6-7H;/q2*-1; |
| InChIKey | OCVLQSDFKCXYLR-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.16 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|