C16H22N2 — CID 58793158
1,9-dimethyl-2-propyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 58793158) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1,9-dimethyl-2-propyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1,9-dimethyl-2-propyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58793158 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1,9-dimethyl-2-propyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | CCCN1CCc2c(n(C)c3ccccc23)C1C |
| InChI | InChI=1S/C16H22N2/c1-4-10-18-11-9-14-13-7-5-6-8-15(13)17(3)16(14)12(18)2/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | IOVKPXHMACQPLX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|