About CID 58793302
CID 58793302 (PubChem CID 58793302) has the molecular formula C46H36N2S+2
and a molecular weight of 648.88 g/mol.
Molecular Properties
| Compound Name | CID 58793302 |
| PubChem CID | 58793302 |
| Molecular Formula | C46H36N2S+2 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | — |
| SMILES | CCc1ccc2c(c1)C1(Cc3cc4c(cc3C1)C1(c3ccccc3-c3cccc[n+]31)[n+]1ccccc1-4)c1cc(Cc3ccc(C)s3)ccc1-2 |
| InChI | InChI=1S/C46H36N2S/c1-3-30-15-18-35-36-19-16-31(22-34-17-14-29(2)49-34)24-41(36)45(40(35)23-30)27-32-25-38-42(26-33(32)28-45)46(48-21-9-7-13-44(38)48)39-11-5-4-10-37(39)43-12-6-8-20-47(43)46/h4-21,23-26H,3,22,27-28H2,1-2H3/q+2 |
| InChIKey | PPJOMOXUJAAXHW-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58793302 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58793302?
The IUPAC name of CID 58793302 (CID 58793302) is not available.
What is the SMILES notation for CID 58793302?
The canonical SMILES for CID 58793302 is CCc1ccc2c(c1)C1(Cc3cc4c(cc3C1)C1(c3ccccc3-c3cccc[n+]31)[n+]1ccccc1-4)c1cc(Cc3ccc(C)s3)ccc1-2.
What is the InChIKey of CID 58793302?
The InChIKey is PPJOMOXUJAAXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H36N2S/c1-3-30-15-18-35-36-19-16-31(22-34-17-14-29(2)49-34)24-41(36)45(40(35)23-30)27-32-25-38-42(26-33(32)28-45)46(48-21-9-7-13-44(38)48)39-11-5-4-10-37(39)43-12-6-8-20-47(43)46/h4-21,23-26H,3,22,27-28H2,1-2H3/q+2.
What are the key properties of CID 58793302?
CID 58793302 has a molecular weight of 648.88 g/mol, XLogP of 9.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58793302 is sourced from PubChem (CID 58793302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).