C27H23F6NOS — CID 58793454
5-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene-4-thione (PubChem CID 58793454) has the molecular formula C27H23F6NOS and a molecular weight of 523.54 g/mol. Its IUPAC name is 5-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene-4-thione.
| Compound Name | 5-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene-4-thione |
|---|---|
| PubChem CID | 58793454 |
| Molecular Formula | C27H23F6NOS |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 5-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene-4-thione |
| SMILES | Cc1c(C/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=S)oc2c3c4c(cc12)CCCN4CCC3 |
| InChI | InChI=1S/C27H23F6NOS/c1-15-20(7-2-5-16-11-18(26(28,29)30)14-19(12-16)27(31,32)33)25(36)35-24-21-8-4-10-34-9-3-6-17(23(21)34)13-22(15)24/h2,5,11-14H,3-4,6-10H2,1H3/b5-2+ |
| InChIKey | YQMVXZXVNKMVAA-GORDUTHDSA-N |
| XLogP | 8.46 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|