C30H49NO — CID 58793767
(10R,14S,16S,20S)-10,14,16,20-tetramethyl-7-propan-2-yloxy-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene (PubChem CID 58793767) has the molecular formula C30H49NO and a molecular weight of 439.73 g/mol. Its IUPAC name is (10R,14S,16S,20S)-10,14,16,20-tetramethyl-7-propan-2-yloxy-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene.
| Compound Name | (10R,14S,16S,20S)-10,14,16,20-tetramethyl-7-propan-2-yloxy-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene |
|---|---|
| PubChem CID | 58793767 |
| Molecular Formula | C30H49NO |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.38 |
| IUPAC Name | (10R,14S,16S,20S)-10,14,16,20-tetramethyl-7-propan-2-yloxy-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene |
| SMILES | CC(C)OC1CC[C@@]2(C)C(=CCC3C4CC5C(C(C)C6CC[C@H](C)CN65)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C30H49NO/c1-18(2)32-22-11-13-29(5)21(15-22)8-9-23-24(29)12-14-30(6)25(23)16-27-28(30)20(4)26-10-7-19(3)17-31(26)27/h8,18-20,22-28H,7,9-17H2,1-6H3/t19-,20?,22?,23?,24?,25?,26?,27?,28?,29-,30-/m0/s1 |
| InChIKey | HXODLJZLMUWIIO-MOXPFRGISA-N |
| XLogP | 7.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|