C33H40FN3O4 — CID 58793849
N-[2-[4-fluoro-2-[2-[(3R,4R)-4-[4-[(3S)-1-phenylpyrrolidin-3-yl]oxyphenyl]piperidin-3-yl]oxyethoxy]phenyl]ethyl]acetamide (PubChem CID 58793849) has the molecular formula C33H40FN3O4 and a molecular weight of 561.70 g/mol. Its IUPAC name is N-[2-[4-fluoro-2-[2-[(3R,4R)-4-[4-[(3S)-1-phenylpyrrolidin-3-yl]oxyphenyl]piperidin-3-yl]oxyethoxy]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-fluoro-2-[2-[(3R,4R)-4-[4-[(3S)-1-phenylpyrrolidin-3-yl]oxyphenyl]piperidin-3-yl]oxyethoxy]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 58793849 |
| Molecular Formula | C33H40FN3O4 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | N-[2-[4-fluoro-2-[2-[(3R,4R)-4-[4-[(3S)-1-phenylpyrrolidin-3-yl]oxyphenyl]piperidin-3-yl]oxyethoxy]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(F)cc1OCCO[C@H]1CNCC[C@@H]1c1ccc(O[C@H]2CCN(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C33H40FN3O4/c1-24(38)36-17-13-26-7-10-27(34)21-32(26)39-19-20-40-33-22-35-16-14-31(33)25-8-11-29(12-9-25)41-30-15-18-37(23-30)28-5-3-2-4-6-28/h2-12,21,30-31,33,35H,13-20,22-23H2,1H3,(H,36,38)/t30-,31+,33-/m0/s1 |
| InChIKey | GNFRCORWFIDSHU-PZWMIYICSA-N |
| XLogP | 4.70 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|