C17H23ClFN3O3 — CID 58793956
tert-butyl N-[4-[(4-carbonochloridoyl-4-fluoropiperidin-1-yl)methyl]-2-pyridinyl]carbamate (PubChem CID 58793956) has the molecular formula C17H23ClFN3O3 and a molecular weight of 371.84 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-carbonochloridoyl-4-fluoropiperidin-1-yl)methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-carbonochloridoyl-4-fluoropiperidin-1-yl)methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58793956 |
| Molecular Formula | C17H23ClFN3O3 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl N-[4-[(4-carbonochloridoyl-4-fluoropiperidin-1-yl)methyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CN2CCC(F)(C(=O)Cl)CC2)ccn1 |
| InChI | InChI=1S/C17H23ClFN3O3/c1-16(2,3)25-15(24)21-13-10-12(4-7-20-13)11-22-8-5-17(19,6-9-22)14(18)23/h4,7,10H,5-6,8-9,11H2,1-3H3,(H,20,21,24) |
| InChIKey | OMTYZKBSGUHCJK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|