About 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole
6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole (PubChem CID 58794222) has the molecular formula C21H16N4O3
and a molecular weight of 372.38 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole |
| PubChem CID | 58794222 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3nc4ccc(C5=NCCC5)cc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C21H16N4O3/c26-25(27)15-6-3-13(4-7-15)19-9-10-20(28-19)21-23-17-8-5-14(12-18(17)24-21)16-2-1-11-22-16/h3-10,12H,1-2,11H2,(H,23,24) |
| InChIKey | VXAQJHKUSZIBAO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The IUPAC name of 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole (CID 58794222) is 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole.
What is the SMILES notation for 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The canonical SMILES for 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole is O=[N+]([O-])c1ccc(-c2ccc(-c3nc4ccc(C5=NCCC5)cc4[nH]3)o2)cc1.
What is the InChIKey of 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
The InChIKey is VXAQJHKUSZIBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O3/c26-25(27)15-6-3-13(4-7-15)19-9-10-20(28-19)21-23-17-8-5-14(12-18(17)24-21)16-2-1-11-22-16/h3-10,12H,1-2,11H2,(H,23,24).
What are the key properties of 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole?
6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole has a molecular weight of 372.38 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dihydro-2H-pyrrol-5-yl)-2-[5-(4-nitrophenyl)furan-2-yl]-1H-benzimidazole is sourced from PubChem (CID 58794222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).