About 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid
3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid (PubChem CID 58794605) has the molecular formula C10H22NO4PS
and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid |
| PubChem CID | 58794605 |
| Molecular Formula | C10H22NO4PS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN[C@H]1CCCC[C@@H]1OCP |
| InChI | InChI=1S/C10H22NO4PS/c12-17(13,14)7-3-6-11-9-4-1-2-5-10(9)15-8-16/h9-11H,1-8,16H2,(H,12,13,14)/t9-,10-/m0/s1 |
| InChIKey | ZGAHASAIMQRHFD-UWVGGRQHSA-N |
| XLogP | 1.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid?
The IUPAC name of 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid (CID 58794605) is 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid.
What is the SMILES notation for 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid?
The canonical SMILES for 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid is O=S(=O)(O)CCCN[C@H]1CCCC[C@@H]1OCP.
What is the InChIKey of 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid?
The InChIKey is ZGAHASAIMQRHFD-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H22NO4PS/c12-17(13,14)7-3-6-11-9-4-1-2-5-10(9)15-8-16/h9-11H,1-8,16H2,(H,12,13,14)/t9-,10-/m0/s1.
What are the key properties of 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid?
3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid has a molecular weight of 283.33 g/mol, XLogP of 1.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2S)-2-(phosphanylmethoxy)cyclohexyl]amino]propane-1-sulfonic acid is sourced from PubChem (CID 58794605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).