C17H20O5 — CID 58794648
methyl 2-[(6aR)-5-(4-methoxyphenyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]prop-2-enoate (PubChem CID 58794648) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl 2-[(6aR)-5-(4-methoxyphenyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]prop-2-enoate.
| Compound Name | methyl 2-[(6aR)-5-(4-methoxyphenyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58794648 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl 2-[(6aR)-5-(4-methoxyphenyl)-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@]12CC(c3ccc(OC)cc3)OC1CCO2 |
| InChI | InChI=1S/C17H20O5/c1-11(16(18)20-3)17-10-14(22-15(17)8-9-21-17)12-4-6-13(19-2)7-5-12/h4-7,14-15H,1,8-10H2,2-3H3/t14?,15?,17-/m1/s1 |
| InChIKey | NJHATUXNHNGRIP-VMBOVVBDSA-N |
| XLogP | 2.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|