C11H12BrN3O2 — CID 58794707
6-(3-bromophenyl)-3,6-dimethyl-1,3,5-triazinane-2,4-dione (PubChem CID 58794707) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 6-(3-bromophenyl)-3,6-dimethyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-(3-bromophenyl)-3,6-dimethyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 58794707 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 6-(3-bromophenyl)-3,6-dimethyl-1,3,5-triazinane-2,4-dione |
| SMILES | CN1C(=O)NC(C)(c2cccc(Br)c2)NC1=O |
| InChI | InChI=1S/C11H12BrN3O2/c1-11(7-4-3-5-8(12)6-7)13-9(16)15(2)10(17)14-11/h3-6H,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | WNLBSBGPIUFRKR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |