About 4,7-diamino-2,3-dihydro-1H-inden-2-ol
4,7-diamino-2,3-dihydro-1H-inden-2-ol (PubChem CID 58794764) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 4,7-diamino-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 4,7-diamino-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 58794764 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4,7-diamino-2,3-dihydro-1H-inden-2-ol |
| SMILES | Nc1ccc(N)c2c1CC(O)C2 |
| InChI | InChI=1S/C9H12N2O/c10-8-1-2-9(11)7-4-5(12)3-6(7)8/h1-2,5,12H,3-4,10-11H2 |
| InChIKey | VSNLSKLLSKVIAJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diamino-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diamino-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 4,7-diamino-2,3-dihydro-1H-inden-2-ol (CID 58794764) is 4,7-diamino-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 4,7-diamino-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 4,7-diamino-2,3-dihydro-1H-inden-2-ol is Nc1ccc(N)c2c1CC(O)C2.
What is the InChIKey of 4,7-diamino-2,3-dihydro-1H-inden-2-ol?
The InChIKey is VSNLSKLLSKVIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c10-8-1-2-9(11)7-4-5(12)3-6(7)8/h1-2,5,12H,3-4,10-11H2.
What are the key properties of 4,7-diamino-2,3-dihydro-1H-inden-2-ol?
4,7-diamino-2,3-dihydro-1H-inden-2-ol has a molecular weight of 164.21 g/mol, XLogP of 0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diamino-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 58794764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).