C44H27F6N3O3 — CID 58795319
2-[4-[2-[4-[3-[3-(1,3-benzoxazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile (PubChem CID 58795319) has the molecular formula C44H27F6N3O3 and a molecular weight of 759.71 g/mol. Its IUPAC name is 2-[4-[2-[4-[3-[3-(1,3-benzoxazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile.
| Compound Name | 2-[4-[2-[4-[3-[3-(1,3-benzoxazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 58795319 |
| Molecular Formula | C44H27F6N3O3 |
| Molecular Weight | 759.71 g/mol |
| Exact Mass | 759.20 |
| IUPAC Name | 2-[4-[2-[4-[3-[3-(1,3-benzoxazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile |
| SMILES | Cc1ccc(-c2cccc(Oc3ccc(C(c4ccc(Oc5cccc(C)c5C#N)cc4)(C(F)(F)F)C(F)(F)F)cc3)c2C#N)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C44H27F6N3O3/c1-26-7-5-11-38(35(26)24-51)54-31-19-15-29(16-20-31)42(43(45,46)47,44(48,49)50)30-17-21-32(22-18-30)55-39-12-6-8-33(36(39)25-52)28-14-13-27(2)34(23-28)41-53-37-9-3-4-10-40(37)56-41/h3-23H,1-2H3 |
| InChIKey | ZYMWLTNNQJOIEQ-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.71 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |