C11H20O3 — CID 58795447
(2R)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-en-1-ol (PubChem CID 58795447) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2R)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-en-1-ol.
| Compound Name | (2R)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 58795447 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2R)-2-[(4R,5S)-2,5-dimethyl-1,3-dioxan-4-yl]pent-4-en-1-ol |
| SMILES | C=CC[C@H](CO)[C@@H]1OC(C)OC[C@@H]1C |
| InChI | InChI=1S/C11H20O3/c1-4-5-10(6-12)11-8(2)7-13-9(3)14-11/h4,8-12H,1,5-7H2,2-3H3/t8-,9?,10+,11+/m0/s1 |
| InChIKey | BLSRNSNYFUFXEK-PIOBBSKYSA-N |
| XLogP | 1.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|