C20H36O4 — CID 58795457
tert-butyl (5S,6R,7S,8S)-5-hydroxy-4,4,6,7,8-pentamethyl-3-oxoundec-10-enoate (PubChem CID 58795457) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is tert-butyl (5S,6R,7S,8S)-5-hydroxy-4,4,6,7,8-pentamethyl-3-oxoundec-10-enoate.
| Compound Name | tert-butyl (5S,6R,7S,8S)-5-hydroxy-4,4,6,7,8-pentamethyl-3-oxoundec-10-enoate |
|---|---|
| PubChem CID | 58795457 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | tert-butyl (5S,6R,7S,8S)-5-hydroxy-4,4,6,7,8-pentamethyl-3-oxoundec-10-enoate |
| SMILES | C=CC[C@H](C)[C@H](C)[C@@H](C)[C@H](O)C(C)(C)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36O4/c1-10-11-13(2)14(3)15(4)18(23)20(8,9)16(21)12-17(22)24-19(5,6)7/h10,13-15,18,23H,1,11-12H2,2-9H3/t13-,14-,15+,18-/m0/s1 |
| InChIKey | RJXZKSUMQPDAIT-AFIMGQEJSA-N |
| XLogP | 4.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|