C28H34N6O2S — CID 58795940
(2Z)-2-[(5E)-5-[[3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]ethyl]anilino]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(cyanomethyl)acetamide (PubChem CID 58795940) has the molecular formula C28H34N6O2S and a molecular weight of 518.69 g/mol. Its IUPAC name is (2Z)-2-[(5E)-5-[[3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]ethyl]anilino]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(cyanomethyl)acetamide.
| Compound Name | (2Z)-2-[(5E)-5-[[3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]ethyl]anilino]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 58795940 |
| Molecular Formula | C28H34N6O2S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2Z)-2-[(5E)-5-[[3-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]ethyl]anilino]methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-(cyanomethyl)acetamide |
| SMILES | CCn1c(=O)/c(=C\Nc2cccc(CCN3CC[C@H]4CCCC[C@@H]4C3)c2)s/c1=C(/C#N)C(=O)NCC#N |
| InChI | InChI=1S/C28H34N6O2S/c1-2-34-27(36)25(37-28(34)24(17-30)26(35)31-13-12-29)18-32-23-9-5-6-20(16-23)10-14-33-15-11-21-7-3-4-8-22(21)19-33/h5-6,9,16,18,21-22,32H,2-4,7-8,10-11,13-15,19H2,1H3,(H,31,35)/b25-18+,28-24-/t21-,22-/m1/s1 |
| InChIKey | AMVTVMMRVZXYJB-BICIKOJZSA-N |
| XLogP | 2.15 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|