C9H14N2O3 — CID 587967
N-(1,5,5-trimethyl-2,4-dioxopyrrolidin-3-yl)acetamide (PubChem CID 587967) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(1,5,5-trimethyl-2,4-dioxopyrrolidin-3-yl)acetamide.
| Compound Name | N-(1,5,5-trimethyl-2,4-dioxopyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 587967 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(1,5,5-trimethyl-2,4-dioxopyrrolidin-3-yl)acetamide |
| SMILES | CC(=O)NC1C(=O)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C9H14N2O3/c1-5(12)10-6-7(13)9(2,3)11(4)8(6)14/h6H,1-4H3,(H,10,12) |
| InChIKey | CALUHEIREXWFLN-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|