About 3-N-methylbutane-2,3-diimine
3-N-methylbutane-2,3-diimine (PubChem CID 58796730) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 3-N-methylbutane-2,3-diimine.
Molecular Properties
| Compound Name | 3-N-methylbutane-2,3-diimine |
| PubChem CID | 58796730 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 3-N-methylbutane-2,3-diimine |
| SMILES | [H]/N=C(C)/C(C)=N/C |
| InChI | InChI=1S/C5H10N2/c1-4(6)5(2)7-3/h6H,1-3H3/b6-4+,7-5+ |
| InChIKey | GZJJANJCRZOBNU-YDFGWWAZSA-N |
| XLogP | 1.12 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-N-methylbutane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methylbutane-2,3-diimine?
The IUPAC name of 3-N-methylbutane-2,3-diimine (CID 58796730) is 3-N-methylbutane-2,3-diimine.
What is the SMILES notation for 3-N-methylbutane-2,3-diimine?
The canonical SMILES for 3-N-methylbutane-2,3-diimine is [H]/N=C(C)/C(C)=N/C.
What is the InChIKey of 3-N-methylbutane-2,3-diimine?
The InChIKey is GZJJANJCRZOBNU-YDFGWWAZSA-N. The full InChI is InChI=1S/C5H10N2/c1-4(6)5(2)7-3/h6H,1-3H3/b6-4+,7-5+.
What are the key properties of 3-N-methylbutane-2,3-diimine?
3-N-methylbutane-2,3-diimine has a molecular weight of 98.15 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methylbutane-2,3-diimine is sourced from PubChem (CID 58796730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).