C17H27N3 — CID 58796824
1,3-ditert-butyl-4,5,6-trimethylpyrazolo[5,4-b]pyridine (PubChem CID 58796824) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 1,3-ditert-butyl-4,5,6-trimethylpyrazolo[5,4-b]pyridine.
| Compound Name | 1,3-ditert-butyl-4,5,6-trimethylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 58796824 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 1,3-ditert-butyl-4,5,6-trimethylpyrazolo[5,4-b]pyridine |
| SMILES | Cc1nc2c(c(C(C)(C)C)nn2C(C)(C)C)c(C)c1C |
| InChI | InChI=1S/C17H27N3/c1-10-11(2)13-14(16(4,5)6)19-20(17(7,8)9)15(13)18-12(10)3/h1-9H3 |
| InChIKey | HFPDSCBLVXUQKS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |