C21H25F2N5O2S — CID 58797005
N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-3,4-difluoro-N-methylbenzenesulfonamide (PubChem CID 58797005) has the molecular formula C21H25F2N5O2S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-3,4-difluoro-N-methylbenzenesulfonamide.
| Compound Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-3,4-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58797005 |
| Molecular Formula | C21H25F2N5O2S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-3,4-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C)CCCNc1nc(CN(C)S(=O)(=O)c2ccc(F)c(F)c2)nc2ccccc12 |
| InChI | InChI=1S/C21H25F2N5O2S/c1-27(2)12-6-11-24-21-16-7-4-5-8-19(16)25-20(26-21)14-28(3)31(29,30)15-9-10-17(22)18(23)13-15/h4-5,7-10,13H,6,11-12,14H2,1-3H3,(H,24,25,26) |
| InChIKey | XYXSHSXUFBTBCN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|