C8H13N3O2 — CID 58797869
(2R)-1-N,2-N-dimethyl-2,5-dihydropyrrole-1,2-dicarboxamide (PubChem CID 58797869) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2R)-1-N,2-N-dimethyl-2,5-dihydropyrrole-1,2-dicarboxamide.
| Compound Name | (2R)-1-N,2-N-dimethyl-2,5-dihydropyrrole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 58797869 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (2R)-1-N,2-N-dimethyl-2,5-dihydropyrrole-1,2-dicarboxamide |
| SMILES | CNC(=O)[C@H]1C=CCN1C(=O)NC |
| InChI | InChI=1S/C8H13N3O2/c1-9-7(12)6-4-3-5-11(6)8(13)10-2/h3-4,6H,5H2,1-2H3,(H,9,12)(H,10,13)/t6-/m1/s1 |
| InChIKey | GSUQPOGLNHZTSJ-ZCFIWIBFSA-N |
| XLogP | -0.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|