About (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide
(2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 58797881) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
| PubChem CID | 58797881 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C=CCN1 |
| InChI | InChI=1S/C6H10N2O/c1-7-6(9)5-3-2-4-8-5/h2-3,5,8H,4H2,1H3,(H,7,9)/t5-/m1/s1 |
| InChIKey | BALLEEZOOLVFQV-RXMQYKEDSA-N |
| XLogP | -0.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The IUPAC name of (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide (CID 58797881) is (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide.
What is the SMILES notation for (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The canonical SMILES for (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide is CNC(=O)[C@H]1C=CCN1.
What is the InChIKey of (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
The InChIKey is BALLEEZOOLVFQV-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10N2O/c1-7-6(9)5-3-2-4-8-5/h2-3,5,8H,4H2,1H3,(H,7,9)/t5-/m1/s1.
What are the key properties of (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide?
(2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide has a molecular weight of 126.16 g/mol, XLogP of -0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-methyl-2,5-dihydro-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 58797881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).