C12H10O6 — CID 58798082
1,5-dihydroxy-6-(hydroxymethoxy)naphthalene-2-carboxylic acid (PubChem CID 58798082) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,5-dihydroxy-6-(hydroxymethoxy)naphthalene-2-carboxylic acid.
| Compound Name | 1,5-dihydroxy-6-(hydroxymethoxy)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58798082 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1,5-dihydroxy-6-(hydroxymethoxy)naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(O)c(OCO)ccc2c1O |
| InChI | InChI=1S/C12H10O6/c13-5-18-9-4-3-6-7(11(9)15)1-2-8(10(6)14)12(16)17/h1-4,13-15H,5H2,(H,16,17) |
| InChIKey | UHGOUFHGMDVJRO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|