C34H45N6+ — CID 58798097
5-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]diazenyl]-N,N-dibutylpyridin-2-amine (PubChem CID 58798097) has the molecular formula C34H45N6+ and a molecular weight of 537.78 g/mol. Its IUPAC name is 5-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]diazenyl]-N,N-dibutylpyridin-2-amine.
| Compound Name | 5-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]diazenyl]-N,N-dibutylpyridin-2-amine |
|---|---|
| PubChem CID | 58798097 |
| Molecular Formula | C34H45N6+ |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.37 |
| IUPAC Name | 5-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]diazenyl]-N,N-dibutylpyridin-2-amine |
| SMILES | CCCCN(CCCC)c1ccc(/N=N/c2n(-c3c(C)cc(C)cc3C)cc[n+]2-c2c(C)cc(C)cc2C)cn1 |
| InChI | InChI=1S/C34H45N6/c1-9-11-15-38(16-12-10-2)31-14-13-30(23-35-31)36-37-34-39(32-26(5)19-24(3)20-27(32)6)17-18-40(34)33-28(7)21-25(4)22-29(33)8/h13-14,17-23H,9-12,15-16H2,1-8H3/q+1 |
| InChIKey | BJMPLIAMONAVPE-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|