C11H14O6 — CID 587981
methyl 2-(2-methoxy-2-oxoethyl)-3,4-dimethyl-5-oxofuran-2-carboxylate (PubChem CID 587981) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 2-(2-methoxy-2-oxoethyl)-3,4-dimethyl-5-oxofuran-2-carboxylate.
| Compound Name | methyl 2-(2-methoxy-2-oxoethyl)-3,4-dimethyl-5-oxofuran-2-carboxylate |
|---|---|
| PubChem CID | 587981 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 2-(2-methoxy-2-oxoethyl)-3,4-dimethyl-5-oxofuran-2-carboxylate |
| SMILES | COC(=O)CC1(C(=O)OC)OC(=O)C(C)=C1C |
| InChI | InChI=1S/C11H14O6/c1-6-7(2)11(10(14)16-4,17-9(6)13)5-8(12)15-3/h5H2,1-4H3 |
| InChIKey | KKNRZRBIEBJKAT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|