C13H26O — CID 58798517
(Z)-1-(3,3-dimethylbutoxy)-4,4-dimethylpent-2-ene (PubChem CID 58798517) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (Z)-1-(3,3-dimethylbutoxy)-4,4-dimethylpent-2-ene.
| Compound Name | (Z)-1-(3,3-dimethylbutoxy)-4,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 58798517 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (Z)-1-(3,3-dimethylbutoxy)-4,4-dimethylpent-2-ene |
| SMILES | CC(C)(C)/C=C\COCCC(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-12(2,3)8-7-10-14-11-9-13(4,5)6/h7-8H,9-11H2,1-6H3/b8-7- |
| InChIKey | HWBHKMGNGMJGMW-FPLPWBNLSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|