About (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene
(Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene (PubChem CID 58798520) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene.
Molecular Properties
| Compound Name | (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene |
| PubChem CID | 58798520 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene |
| SMILES | CC(C)(C)/C=C\CCCSC(C)(C)C |
| InChI | InChI=1S/C13H26S/c1-12(2,3)10-8-7-9-11-14-13(4,5)6/h8,10H,7,9,11H2,1-6H3/b10-8- |
| InChIKey | BIHLASIDVLOKTQ-NTMALXAHSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene?
The IUPAC name of (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene (CID 58798520) is (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene.
What is the SMILES notation for (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene?
The canonical SMILES for (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene is CC(C)(C)/C=C\CCCSC(C)(C)C.
What is the InChIKey of (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene?
The InChIKey is BIHLASIDVLOKTQ-NTMALXAHSA-N. The full InChI is InChI=1S/C13H26S/c1-12(2,3)10-8-7-9-11-14-13(4,5)6/h8,10H,7,9,11H2,1-6H3/b10-8-.
What are the key properties of (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene?
(Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene has a molecular weight of 214.42 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-tert-butylsulfanyl-2,2-dimethylhept-3-ene is sourced from PubChem (CID 58798520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).