C9H11IO3 — CID 58798845
(3aS,5aR,6aR,6bS)-4-iodo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole (PubChem CID 58798845) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (3aS,5aR,6aR,6bS)-4-iodo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole.
| Compound Name | (3aS,5aR,6aR,6bS)-4-iodo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole |
|---|---|
| PubChem CID | 58798845 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (3aS,5aR,6aR,6bS)-4-iodo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole |
| SMILES | CC1(C)O[C@H]2[C@@H]3O[C@@H]3C=C(I)[C@H]2O1 |
| InChI | InChI=1S/C9H11IO3/c1-9(2)12-6-4(10)3-5-7(11-5)8(6)13-9/h3,5-8H,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | CONVPYYRXUHYFD-WCTZXXKLSA-N |
| XLogP | 1.61 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|