C19H33N — CID 58798851
(1S,4R,5R,6S)-N,4,5,6-tetramethyl-N-[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine (PubChem CID 58798851) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (1S,4R,5R,6S)-N,4,5,6-tetramethyl-N-[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine.
| Compound Name | (1S,4R,5R,6S)-N,4,5,6-tetramethyl-N-[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 58798851 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (1S,4R,5R,6S)-N,4,5,6-tetramethyl-N-[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine |
| SMILES | C[C@H]1[C@H](C)[C@@H](N(C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)C=C[C@H]1C |
| InChI | InChI=1S/C19H33N/c1-12-8-10-18(16(5)14(12)3)20(7)19-11-9-13(2)15(4)17(19)6/h8-19H,1-7H3/t12-,13-,14-,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | ZDMBVVLCCODJNZ-UYKRBRGISA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|