C46H80N2 — CID 58798878
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]decane-1,10-diamine (PubChem CID 58798878) has the molecular formula C46H80N2 and a molecular weight of 661.16 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]decane-1,10-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]decane-1,10-diamine |
|---|---|
| PubChem CID | 58798878 |
| Molecular Formula | C46H80N2 |
| Molecular Weight | 661.16 g/mol |
| Exact Mass | 660.63 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]decane-1,10-diamine |
| SMILES | C[C@@H]1[C@H](C)C=CC(N(CCCCCCCCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C46H80N2/c1-31-21-25-43(39(9)35(31)5)47(44-26-22-32(2)36(6)40(44)10)29-19-17-15-13-14-16-18-20-30-48(45-27-23-33(3)37(7)41(45)11)46-28-24-34(4)38(8)42(46)12/h21-28,31-46H,13-20,29-30H2,1-12H3/t31-,32-,33-,34-,35-,36-,37-,38-,39+,40+,41+,42+,43+,44+,45+,46?/m1/s1 |
| InChIKey | XZLCMIAZRURUHO-UTOWLDTJSA-N |
| XLogP | 12.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.16 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|