C40H68N2 — CID 58798881
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]butane-1,4-diamine (PubChem CID 58798881) has the molecular formula C40H68N2 and a molecular weight of 577.00 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]butane-1,4-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 58798881 |
| Molecular Formula | C40H68N2 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.54 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]butane-1,4-diamine |
| SMILES | CC1[C@H](C)C=C[C@H](N(CCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C40H68N2/c1-25-15-19-37(33(9)29(25)5)41(38-20-16-26(2)30(6)34(38)10)23-13-14-24-42(39-21-17-27(3)31(7)35(39)11)40-22-18-28(4)32(8)36(40)12/h15-22,25-40H,13-14,23-24H2,1-12H3/t25-,26-,27-,28-,29-,30-,31-,32?,33+,34+,35+,36+,37+,38+,39+,40+/m1/s1 |
| InChIKey | FOPGILPNQBWWIM-QZBYIOCESA-N |
| XLogP | 9.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|