C9H12ClIO3 — CID 58798886
(4S,5R)-5-chloro-7-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 58798886) has the molecular formula C9H12ClIO3 and a molecular weight of 330.55 g/mol. Its IUPAC name is (4S,5R)-5-chloro-7-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (4S,5R)-5-chloro-7-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 58798886 |
| Molecular Formula | C9H12ClIO3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | (4S,5R)-5-chloro-7-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)OC2C(I)=C[C@@H](Cl)[C@@H](O)C2O1 |
| InChI | InChI=1S/C9H12ClIO3/c1-9(2)13-7-5(11)3-4(10)6(12)8(7)14-9/h3-4,6-8,12H,1-2H3/t4-,6-,7?,8?/m1/s1 |
| InChIKey | UBBIVMCHRFZFMF-NTDMHGHKSA-N |
| XLogP | 1.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|