C41H70N2 — CID 58798898
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]pentane-1,5-diamine (PubChem CID 58798898) has the molecular formula C41H70N2 and a molecular weight of 591.03 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]pentane-1,5-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 58798898 |
| Molecular Formula | C41H70N2 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.55 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]pentane-1,5-diamine |
| SMILES | CC1[C@H](C)C=C[C@H](N(CCCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C41H70N2/c1-26-16-20-38(34(9)30(26)5)42(39-21-17-27(2)31(6)35(39)10)24-14-13-15-25-43(40-22-18-28(3)32(7)36(40)11)41-23-19-29(4)33(8)37(41)12/h16-23,26-41H,13-15,24-25H2,1-12H3/t26-,27-,28-,29-,30-,31-,32-,33?,34+,35+,36+,37+,38+,39+,40+,41+/m1/s1 |
| InChIKey | CJBNAGPMIPISEE-LKECILLRSA-N |
| XLogP | 10.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|