C43H74N2 — CID 58798915
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]heptane-1,7-diamine (PubChem CID 58798915) has the molecular formula C43H74N2 and a molecular weight of 619.08 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]heptane-1,7-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 58798915 |
| Molecular Formula | C43H74N2 |
| Molecular Weight | 619.08 g/mol |
| Exact Mass | 618.59 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]heptane-1,7-diamine |
| SMILES | C[C@@H]1[C@H](C)C=CC(N(CCCCCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C43H74N2/c1-28-18-22-40(36(9)32(28)5)44(41-23-19-29(2)33(6)37(41)10)26-16-14-13-15-17-27-45(42-24-20-30(3)34(7)38(42)11)43-25-21-31(4)35(8)39(43)12/h18-25,28-43H,13-17,26-27H2,1-12H3/t28-,29-,30-,31-,32-,33-,34-,35-,36+,37+,38+,39+,40+,41+,42+,43?/m1/s1 |
| InChIKey | LOORNMGCOJCHRB-AULSPCIHSA-N |
| XLogP | 10.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.08 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|